Introduction：Basic information about CAS 10572-16-4|3-(4-nitrophenyl)propanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(4-nitrophenyl)propanoic acid |
|---|
| CAS Number | 10572-16-4 | Molecular Weight | 211.17100 |
|---|
| Density | 1.38g/cm3 | Boiling Point | 383.6ºC at 760mmHg |
|---|
| Molecular Formula | C9H9NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 185.8ºC |
|---|
Names
| Name | 3-(4-Nitrophenoxy)propionic Acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.38g/cm3 |
|---|
| Boiling Point | 383.6ºC at 760mmHg |
|---|
| Molecular Formula | C9H9NO5 |
|---|
| Molecular Weight | 211.17100 |
|---|
| Flash Point | 185.8ºC |
|---|
| Exact Mass | 211.04800 |
|---|
| PSA | 92.35000 |
|---|
| LogP | 1.97150 |
|---|
| Vapour Pressure | 1.43E-06mmHg at 25°C |
|---|
| InChIKey | RRQDYEMTBDVXQY-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CCOc1ccc([N+](=O)[O-])cc1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| HS Code | 2918990090 |
|---|
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 3-(p-nitrophenoxy)propionic acid |
| propanoic acid,3-(4-nitrophenoxy)- |
| 3-(4-nitrophenoxy)propanoic acid |
| 3-(4-nitrophenyl)propanoic acid |
| MFCD00126834 |
| adenosine cyclophosphate |
| 3-(p-nitrophenoxy)propanoic acid |
| 3-(4-nitrophenyl)propionic acid |
| 3-(4-nitrophenoxy)propionicacid |
