Introduction：Basic information about CAS 60951-46-4|P-Decyloxybenzylidene p-Aminocinnamic Acid l-2-Methylbutyl Ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | P-Decyloxybenzylidene p-Aminocinnamic Acid l-2-Methylbutyl Ester |
|---|
| CAS Number | 60951-46-4 | Molecular Weight | 477.67800 |
|---|
| Density | 0.98 | Boiling Point | 600ºC |
|---|
| Molecular Formula | C31H43NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 174ºC |
|---|
Names
| Name | P-Decyloxybenzylidene p-Aminocinnamic Acid l-2-Methylbutyl Ester |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.98 |
|---|
| Boiling Point | 600ºC |
|---|
| Molecular Formula | C31H43NO3 |
|---|
| Molecular Weight | 477.67800 |
|---|
| Flash Point | 174ºC |
|---|
| Exact Mass | 477.32400 |
|---|
| PSA | 47.89000 |
|---|
| LogP | 8.55920 |
|---|
| InChIKey | UTIMESSLYFMSPO-YKUNFAGNSA-N |
|---|
| SMILES | CCCCCCCCCCOc1ccc(C=Nc2ccc(C=CC(=O)OCC(C)CC)cc2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2925290090 |
|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| (S)-3-[4-[[[4-(Decyloxy)phenyl]methylene]amino]phenyl]-2-propenoic acid 2-methylbutyl ester |
| 3-[4-[[[4-(Decyloxy)phenyl]methylene]amino]phenyl]-2-propenoic acid (2S)-2-methylbutyl ester |
| d-2-Methylbutyl p-(p-decyloxybenzylideneamino)cinnamate |
| d-p-Decyloxybenzylidene-p'-amino-2-methylbutyl cinnamate |
