Introduction：Basic information about CAS 74163-11-4|10H-Pyridazino[6,1-b]quinazoline-2-carboxylic acid, 8-chloro-10-oxo-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 10H-Pyridazino[6,1-b]quinazoline-2-carboxylic acid, 8-chloro-10-oxo- |
|---|
| CAS Number | 74163-11-4 | Molecular Weight | 275.64700 |
|---|
| Density | 1.7g/cm3 | Boiling Point | 535.1ºC at 760 mmHg |
|---|
| Molecular Formula | C12H6ClN3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 277.4ºC |
|---|
Names
| Name | 8-chloro-10-oxopyridazino[6,1-b]quinazoline-2-carboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.7g/cm3 |
|---|
| Boiling Point | 535.1ºC at 760 mmHg |
|---|
| Molecular Formula | C12H6ClN3O3 |
|---|
| Molecular Weight | 275.64700 |
|---|
| Flash Point | 277.4ºC |
|---|
| Exact Mass | 275.01000 |
|---|
| PSA | 84.56000 |
|---|
| LogP | 1.59430 |
|---|
| Index of Refraction | 1.773 |
|---|
| InChIKey | NKSPRSVGFIUOHW-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc2nc3ccc(Cl)cc3c(=O)n2n1 |
|---|
