Introduction:Basic information about CAS 483367-60-8|6-chloro-3-nitroso-2-phenylimidazo[1,2-b]pyridazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-chloro-3-nitroso-2-phenylimidazo[1,2-b]pyridazine |
|---|
| CAS Number | 483367-60-8 | Molecular Weight | 258.66300 |
|---|
| Density | 1.5g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C12H7ClN4O | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 6-chloro-3-nitroso-2-phenylimidazo[1,2-b]pyridazine |
|---|
Chemical & Physical Properties
| Density | 1.5g/cm3 |
|---|
| Molecular Formula | C12H7ClN4O |
|---|
| Molecular Weight | 258.66300 |
|---|
| Exact Mass | 258.03100 |
|---|
| PSA | 59.62000 |
|---|
| LogP | 3.44760 |
|---|
| Index of Refraction | 1.732 |
|---|
| InChIKey | GVRDUSIHVXSLBE-UHFFFAOYSA-N |
|---|
| SMILES | O=Nc1c(-c2ccccc2)nc2ccc(Cl)nn12 |
|---|