Introduction:Basic information about CAS 483367-56-2|3,6-dichloro-2-thiophen-2-ylimidazo[1,2-b]pyridazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,6-dichloro-2-thiophen-2-ylimidazo[1,2-b]pyridazine |
|---|
| CAS Number | 483367-56-2 | Molecular Weight | 270.13800 |
|---|
| Density | 1.67g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C10H5Cl2N3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3,6-dichloro-2-thiophen-2-ylimidazo[1,2-b]pyridazine |
|---|
Chemical & Physical Properties
| Density | 1.67g/cm3 |
|---|
| Molecular Formula | C10H5Cl2N3S |
|---|
| Molecular Weight | 270.13800 |
|---|
| Exact Mass | 268.95800 |
|---|
| PSA | 58.43000 |
|---|
| LogP | 3.76460 |
|---|
| Index of Refraction | 1.785 |
|---|
| InChIKey | NBLLAWZKPXOFGU-UHFFFAOYSA-N |
|---|
| SMILES | Clc1ccc2nc(-c3cccs3)c(Cl)n2n1 |
|---|