Introduction：Basic information about CAS 74163-13-6|10H-Pyridazino[6,1-b]quinazoline-2-carboxylic acid, 10-oxo-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 10H-Pyridazino[6,1-b]quinazoline-2-carboxylic acid, 10-oxo- |
|---|
| CAS Number | 74163-13-6 | Molecular Weight | 241.20200 |
|---|
| Density | 1.58g/cm3 | Boiling Point | 493ºC at 760 mmHg |
|---|
| Molecular Formula | C12H7N3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 252ºC |
|---|
Names
| Name | 10-oxopyridazino[6,1-b]quinazoline-2-carboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.58g/cm3 |
|---|
| Boiling Point | 493ºC at 760 mmHg |
|---|
| Molecular Formula | C12H7N3O3 |
|---|
| Molecular Weight | 241.20200 |
|---|
| Flash Point | 252ºC |
|---|
| Exact Mass | 241.04900 |
|---|
| PSA | 84.56000 |
|---|
| LogP | 0.94090 |
|---|
| Index of Refraction | 1.762 |
|---|
| InChIKey | ZMKKVDIUCIRSCE-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc2nc3ccccc3c(=O)n2n1 |
|---|
