Introduction：Basic information about CAS 483367-55-1|3,6-dichloro-2-(5-chlorothiophen-2-yl)imidazo[1,2-b]pyridazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,6-dichloro-2-(5-chlorothiophen-2-yl)imidazo[1,2-b]pyridazine |
|---|
| CAS Number | 483367-55-1 | Molecular Weight | 304.58300 |
|---|
| Density | 1.78g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C10H4Cl3N3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3,6-dichloro-2-(5-chlorothiophen-2-yl)imidazo[1,2-b]pyridazine |
|---|
Chemical & Physical Properties
| Density | 1.78g/cm3 |
|---|
| Molecular Formula | C10H4Cl3N3S |
|---|
| Molecular Weight | 304.58300 |
|---|
| Exact Mass | 302.91900 |
|---|
| PSA | 58.43000 |
|---|
| LogP | 4.41800 |
|---|
| Index of Refraction | 1.795 |
|---|
| InChIKey | BKFQPHFPGRTGPB-UHFFFAOYSA-N |
|---|
| SMILES | Clc1ccc2nc(-c3ccc(Cl)s3)c(Cl)n2n1 |
|---|
