Introduction:Basic information about CAS 142674-93-9|3-Pyridazinecarboxamide, 6-[(phenylmethyl)amino], including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Pyridazinecarboxamide, 6-[(phenylmethyl)amino] |
|---|
| CAS Number | 142674-93-9 | Molecular Weight | 228.25000 |
|---|
| Density | 1.306g/cm3 | Boiling Point | 513.3ºC at 760 mmHg |
|---|
| Molecular Formula | C12H12N4O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 264.2ºC |
|---|
Names
| Name | 3-Pyridazinecarboxamide, 6-[(phenylmethyl)amino] |
|---|
Chemical & Physical Properties
| Density | 1.306g/cm3 |
|---|
| Boiling Point | 513.3ºC at 760 mmHg |
|---|
| Molecular Formula | C12H12N4O |
|---|
| Molecular Weight | 228.25000 |
|---|
| Flash Point | 264.2ºC |
|---|
| Exact Mass | 228.10100 |
|---|
| PSA | 80.90000 |
|---|
| LogP | 1.96090 |
|---|
| Vapour Pressure | 1.2E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.672 |
|---|
| InChIKey | UQIVSCTXCWRIIR-UHFFFAOYSA-N |
|---|
| SMILES | NC(=O)c1ccc(NCc2ccccc2)nn1 |
|---|