Introduction:Basic information about CAS 873913-87-2|6-Chloro-2,3-diphenylimidazo[1,2-b]pyridazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Chloro-2,3-diphenylimidazo[1,2-b]pyridazine |
|---|
| CAS Number | 873913-87-2 | Molecular Weight | 305.76100 |
|---|
| Density | 1.286g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C18H12ClN3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 6-Chloro-2,3-diphenylimidazo[1,2-b]pyridazine |
|---|
Chemical & Physical Properties
| Density | 1.286g/cm3 |
|---|
| Molecular Formula | C18H12ClN3 |
|---|
| Molecular Weight | 305.76100 |
|---|
| Exact Mass | 305.07200 |
|---|
| PSA | 30.19000 |
|---|
| LogP | 4.71670 |
|---|
| Index of Refraction | 1.681 |
|---|
| InChIKey | WOPARXSWYJDAQV-UHFFFAOYSA-N |
|---|
| SMILES | Clc1ccc2nc(-c3ccccc3)c(-c3ccccc3)n2n1 |
|---|