Introduction:Basic information about CAS 6015-57-2|5-Chloro-6-nitro-1H-isoindole-1,3(2H)-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Chloro-6-nitro-1H-isoindole-1,3(2H)-dione |
|---|
| CAS Number | 6015-57-2 | Molecular Weight | 226.573 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 626.8ºC at 760 mmHg |
|---|
| Molecular Formula | C8H3ClN2O4 | Melting Point | 201 °C |
|---|
| MSDS | / | Flash Point | 332.9ºC |
|---|
Names
| Name | 4-Chloro-5-nitrophthalimide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 626.8ºC at 760 mmHg |
|---|
| Melting Point | 201 °C |
|---|
| Molecular Formula | C8H3ClN2O4 |
|---|
| Molecular Weight | 226.573 |
|---|
| Flash Point | 332.9ºC |
|---|
| Exact Mass | 225.978134 |
|---|
| PSA | 91.99000 |
|---|
| LogP | 1.27 |
|---|
| Index of Refraction | 1.667 |
|---|
| InChIKey | ADLVDYMTBOSDFE-UHFFFAOYSA-N |
|---|
| SMILES | O=C1NC(=O)c2cc([N+](=O)[O-])c(Cl)cc21 |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| HS Code | 2925190090 |
|---|
Customs
| HS Code | 2925190090 |
|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| BUTTPARK 9457-86 |
| MFCD00052331 |
| 5-CHLORO-6-NITROISOINDOLINE-1,3-DIONE |
| 5-chloro-6-nitroso-2,3-dihydro-1H-isoindole-1,3-dione |
| 5-Chloro-6-nitro-1H-isoindole-1,3(2H)-dione |
| 5-Chloro-6-nitrosoisoindoline-1,3-dione |
| 5-chloro-6-nitro-isoindole-1,3-dione |
| 1H-Isoindole-1,3(2H)-dione, 5-chloro-6-nitro- |