Introduction:Basic information about CAS 52413-55-5|ART-CHEM-BB B013517, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ART-CHEM-BB B013517 |
|---|
| CAS Number | 52413-55-5 | Molecular Weight | 273.67100 |
|---|
| Density | 1.445g/cm3 | Boiling Point | 462.8ºC at 760 mmHg |
|---|
| Molecular Formula | C14H8ClNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 233.7ºC |
|---|
Names
| Name | 8-chloro-2-(furan-2-yl)quinoline-4-carboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.445g/cm3 |
|---|
| Boiling Point | 462.8ºC at 760 mmHg |
|---|
| Molecular Formula | C14H8ClNO3 |
|---|
| Molecular Weight | 273.67100 |
|---|
| Flash Point | 233.7ºC |
|---|
| Exact Mass | 273.01900 |
|---|
| PSA | 63.33000 |
|---|
| LogP | 3.84640 |
|---|
| Index of Refraction | 1.672 |
|---|
| InChIKey | CCGVQHQIJOPNNV-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc(-c2ccco2)nc2c(Cl)cccc12 |
|---|