Introduction：Basic information about CAS 7213-65-2|1,4-Methanonaphthalene-5,8-diol,1,4-dihydro-, 5,8-diacetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,4-Methanonaphthalene-5,8-diol,1,4-dihydro-, 5,8-diacetate |
|---|
| CAS Number | 7213-65-2 | Molecular Weight | 258.26900 |
|---|
| Density | 1.268g/cm3 | Boiling Point | 343ºC at 760 mmHg |
|---|
| Molecular Formula | C15H14O4 | Melting Point | 106-108ºC(lit.) |
|---|
| MSDS | / | Flash Point | 167.7ºC |
|---|
Names
| Name | 1,4-dihydro-1,4-methanonaphthalene-5,8-diol diacetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.268g/cm3 |
|---|
| Boiling Point | 343ºC at 760 mmHg |
|---|
| Melting Point | 106-108ºC(lit.) |
|---|
| Molecular Formula | C15H14O4 |
|---|
| Molecular Weight | 258.26900 |
|---|
| Flash Point | 167.7ºC |
|---|
| Exact Mass | 258.08900 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 2.67790 |
|---|
| Index of Refraction | 1.582 |
|---|
| InChIKey | GHNDBDFQIQQOER-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Oc1ccc(OC(C)=O)c2c1C1C=CC2C1 |
|---|
Synonyms
| 3',6'-DIACETOXY-BENZONORBORNADIENE |
| 5,8-diacetoxy-1,4-dihydro-1,4-methano-naphthalene |
| p-diacetyloxybenzonorbornadiene |
| 5,8-Diacetoxy-1,4-dihydro-1,4-methano-naphthalin |
| 5,8-diacetoxy-1,4-dihydro-1,4-methylenonaphthalene |
| 1,4-dihydro-1,4-methanonaphthalene-5,8-diol diace |
| MFCD00167733 |
