Introduction：Basic information about CAS 62658-88-2|mesudipine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | mesudipine |
|---|
| CAS Number | 62658-88-2 | Molecular Weight | 376.47000 |
|---|
| Density | 1.22g/cm3 | Boiling Point | 495.8ºC at 760 mmHg |
|---|
| Molecular Formula | C19H24N2O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 253.6ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.22g/cm3 |
|---|
| Boiling Point | 495.8ºC at 760 mmHg |
|---|
| Molecular Formula | C19H24N2O4S |
|---|
| Molecular Weight | 376.47000 |
|---|
| Flash Point | 253.6ºC |
|---|
| Exact Mass | 376.14600 |
|---|
| PSA | 102.82000 |
|---|
| LogP | 3.49330 |
|---|
| Index of Refraction | 1.575 |
|---|
| InChIKey | DYGIPCPWPHKLMC-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1c1cccnc1SC |
|---|
