Introduction:Basic information about CAS 104902-08-1|Cilutazoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cilutazoline |
|---|
| CAS Number | 104902-08-1 | Molecular Weight | 230.30600 |
|---|
| Density | 1.22g/cm3 | Boiling Point | 426.7ºC at 760mmHg |
|---|
| Molecular Formula | C14H18N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 211.9ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.22g/cm3 |
|---|
| Boiling Point | 426.7ºC at 760mmHg |
|---|
| Molecular Formula | C14H18N2O |
|---|
| Molecular Weight | 230.30600 |
|---|
| Flash Point | 211.9ºC |
|---|
| Exact Mass | 230.14200 |
|---|
| PSA | 33.62000 |
|---|
| LogP | 2.01730 |
|---|
| Vapour Pressure | 4.32E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.63 |
|---|
| InChIKey | JJFSSNDOOJCPLD-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(C2CC2)c(OCC2=NCCN2)c1 |
|---|