Introduction:Basic information about CAS 959238-76-7|4-(Trifluoromethyl)-1H-indole-3-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(Trifluoromethyl)-1H-indole-3-carboxylic acid |
|---|
| CAS Number | 959238-76-7 | Molecular Weight | 229.155 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 402.5±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H6F3NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 197.2±27.3 °C |
|---|
Names
| Name | 4-(trifluoromethyl)-1H-indole-3-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 402.5±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H6F3NO2 |
|---|
| Molecular Weight | 229.155 |
|---|
| Flash Point | 197.2±27.3 °C |
|---|
| Exact Mass | 229.035065 |
|---|
| PSA | 53.09000 |
|---|
| LogP | 2.56 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.598 |
|---|
| InChIKey | ZXHZBUBUBCCBBT-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1c[nH]c2cccc(C(F)(F)F)c12 |
|---|
Synonyms
| 4-(trifluoromethyl)-indole-3-carboxylic acid |
| 1H-Indole-3-carboxylic acid, 4-(trifluoromethyl)- |
| 4-(Trifluoromethyl)-1H-indole-3-carboxylic acid |
| rd-0108 |