Introduction：Basic information about CAS 101657-77-6|4,4'-Methylenebis(2,6-dimethylphenylcyanate), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,4'-Methylenebis(2,6-dimethylphenylcyanate) |
|---|
| CAS Number | 101657-77-6 | Molecular Weight | 306.35800 |
|---|
| Density | 1.14 | Boiling Point | 433ºC |
|---|
| Molecular Formula | C19H18N2O2 | Melting Point | 105ºC |
|---|
| MSDS | / | Flash Point | 162ºC |
|---|
Names
| Name | [4-[(4-cyanato-3,5-dimethylphenyl)methyl]-2,6-dimethylphenyl] cyanate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.14 |
|---|
| Boiling Point | 433ºC |
|---|
| Melting Point | 105ºC |
|---|
| Molecular Formula | C19H18N2O2 |
|---|
| Molecular Weight | 306.35800 |
|---|
| Flash Point | 162ºC |
|---|
| Exact Mass | 306.13700 |
|---|
| PSA | 66.04000 |
|---|
| LogP | 4.23076 |
|---|
| Vapour Pressure | 1.01E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.569 |
|---|
| InChIKey | JNCRKOQSRHDNIO-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(Cc2cc(C)c(OC#N)c(C)c2)cc(C)c1OC#N |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R43 |
|---|
| Safety Phrases | 22-24-37-61 |
|---|
Synonyms
| Cyanic acid,methylenebis(2,6-dimethyl-4,1-phenylene) ester |
| Cyanic acid,C,C'-(methylenebis(2,6-dimethyl-4,1-phenylene)) ester |
| Q150 |
| 4,4'-Methylenebis(2,6-dimethylphenylcyanate) |
