Introduction：Basic information about CAS 1110-40-3|2'H-Pregna-2,4,6-trieno[3,2-c]pyrazol-20-one,21-(acetyloxy)-11,17-dihydroxy, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2'H-Pregna-2,4,6-trieno[3,2-c]pyrazol-20-one,21-(acetyloxy)-11,17-dihydroxy-6,16-dimethyl-2'-phenyl-, (11b,16a)- |
|---|
| CAS Number | 1110-40-3 | Molecular Weight | 530.65500 |
|---|
| Density | 1.33g/cm3 | Boiling Point | 686ºC at 760mmHg |
|---|
| Molecular Formula | C32H38N2O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 368.7ºC |
|---|
Names
| Name | Cortivazol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.33g/cm3 |
|---|
| Boiling Point | 686ºC at 760mmHg |
|---|
| Molecular Formula | C32H38N2O5 |
|---|
| Molecular Weight | 530.65500 |
|---|
| Flash Point | 368.7ºC |
|---|
| Exact Mass | 530.27800 |
|---|
| PSA | 101.65000 |
|---|
| LogP | 4.30060 |
|---|
| Vapour Pressure | 9.21E-20mmHg at 25°C |
|---|
| Index of Refraction | 1.66 |
|---|
| InChIKey | RKHQGWMMUURILY-UHRZLXHJSA-N |
|---|
| SMILES | CC(=O)OCC(=O)C1(O)C(C)CC2C3C=C(C)C4=Cc5c(cnn5-c5ccccc5)CC4(C)C3C(O)CC21C |
|---|
Synonyms
| Cortivasolo [DCIT] |
| CortivazolnnDISCONTINUED |
| Idaltim |
| EINECS 214-175-8 |
| Altim |
| Dilaster |
