Introduction：Basic information about CAS 4697-68-1|uncarine d, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | uncarine d |
|---|
| CAS Number | 4697-68-1 | Molecular Weight | 368.42600 |
|---|
| Density | 1.33 g/cm3 | Boiling Point | 555.2ºC at 760 mmHg |
|---|
| Molecular Formula | C21H24N2O4 | Melting Point | 183-184ºC |
|---|
| MSDS | / | Flash Point | 289.6ºC |
|---|
Names
| Name | uncarine d |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.33 g/cm3 |
|---|
| Boiling Point | 555.2ºC at 760 mmHg |
|---|
| Melting Point | 183-184ºC |
|---|
| Molecular Formula | C21H24N2O4 |
|---|
| Molecular Weight | 368.42600 |
|---|
| Flash Point | 289.6ºC |
|---|
| Exact Mass | 368.17400 |
|---|
| PSA | 67.87000 |
|---|
| LogP | 2.13840 |
|---|
| Index of Refraction | 1.635 |
|---|
| InChIKey | JMIAZDVHNCCPDM-ZUNJVLJPSA-N |
|---|
| SMILES | COC(=O)C1=COC(C)C2CN3CCC4(C(=O)Nc5ccccc54)C3CC12 |
|---|
Synonyms
| Speciophyllin |
| Isopteropodin |
| Uncarin D |
| SPECIOPHYLLINE |
| Isoformosanin |
