Introduction:Basic information about CAS 114150-57-1|4,6-Dioxo-6-phenylhexanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,6-Dioxo-6-phenylhexanoic acid |
|---|
| CAS Number | 114150-57-1 | Molecular Weight | 220.22100 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C12H12O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4,6-Dioxo-6-phenylhexanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C12H12O4 |
|---|
| Molecular Weight | 220.22100 |
|---|
| Exact Mass | 220.07400 |
|---|
| PSA | 71.44000 |
|---|
| LogP | 1.69330 |
|---|
| InChIKey | RYHMWKGXNUBZPO-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CCC(=O)CC(=O)c1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 4,6-dioxo-6-phenyl-hexanoic acid |
| 6-phenyl-4,6-dioxohexanoic acid |
| dioxophenylhexanoicacid |