Introduction:Basic information about CAS 5349-78-0|2(1H)-Quinolinone,4,8-dimethyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2(1H)-Quinolinone,4,8-dimethyl- |
|---|
| CAS Number | 5349-78-0 | Molecular Weight | 173.21100 |
|---|
| Density | 1.107g/cm3 | Boiling Point | 343.3ºC at 760 mmHg |
|---|
| Molecular Formula | C11H11NO | Melting Point | 219-221ºC |
|---|
| MSDS | / | Flash Point | 201.7ºC |
|---|
Names
| Name | 4,8-dimethyl-1H-quinolin-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.107g/cm3 |
|---|
| Boiling Point | 343.3ºC at 760 mmHg |
|---|
| Melting Point | 219-221ºC |
|---|
| Molecular Formula | C11H11NO |
|---|
| Molecular Weight | 173.21100 |
|---|
| Flash Point | 201.7ºC |
|---|
| Exact Mass | 173.08400 |
|---|
| PSA | 33.12000 |
|---|
| LogP | 2.55720 |
|---|
| Index of Refraction | 1.566 |
|---|
| InChIKey | NJUAEGGYLOZMGV-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(=O)[nH]c2c(C)cccc12 |
|---|
Safety Information
Customs
| HS Code | 2933499090 |
|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2-Hydroxy-4,8-dimethyl-chinolin |
| 4,8-Dimethyl-chinolin-2-ol |
| 4,8-dimethyl-2(1H)-quinolinone |
| 4,8-dimethylquinolin-2-ol |
| 4,8-dimethyl-2-hydroxyquinoline |
| 2-hydroxy-4,8-dimethylquinoline |
| dimethylquinolinol |
| 4,8-dimethyl-2-quinolinol |