Introduction：Basic information about CAS 523-54-6|Etymemazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Etymemazine |
|---|
| CAS Number | 523-54-6 | Molecular Weight | 326.49900 |
|---|
| Density | 1.085 g/cm3 | Boiling Point | 457.6ºC at 760 mmHg |
|---|
| Molecular Formula | C20H26N2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 230.6ºC |
|---|
Names
| Name | Etymemazine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.085 g/cm3 |
|---|
| Boiling Point | 457.6ºC at 760 mmHg |
|---|
| Molecular Formula | C20H26N2S |
|---|
| Molecular Weight | 326.49900 |
|---|
| Flash Point | 230.6ºC |
|---|
| Exact Mass | 326.18200 |
|---|
| PSA | 31.78000 |
|---|
| LogP | 5.11440 |
|---|
| Index of Refraction | 1.593 |
|---|
| InChIKey | USKHCLAXJXCWMO-UHFFFAOYSA-N |
|---|
| SMILES | CCc1ccc2c(c1)N(CC(C)CN(C)C)c1ccccc1S2 |
|---|
Safety Information
Customs
| HS Code | 2934300000 |
|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| Aethylmemazin |
| [3-(2-ethyl-phenothiazin-10-yl)-2-methyl-propyl]-dimethyl-amine |
| N-<3-(2-ethyl-10H-10-phenothiazinyl)-2-methylpropyl>-N,N-dimethylamine |
| Ethotrimeprazine |
| 10-(3-DiMethylaMino -2-Methylpropyl)-2-ethylphenothiazine |
| Unii-861J4K81C7 |
| Ethylisobutrazine |
| RP-6484 |
| Diquel |
