Introduction：Basic information about CAS 625853-74-9|5-Hydroxy pioglitazone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Hydroxy pioglitazone |
|---|
| CAS Number | 625853-74-9 | Molecular Weight | 372.43800 |
|---|
| Density | 1.338g/cm3 | Boiling Point | 615.2ºC at 760 mmHg |
|---|
| Molecular Formula | C19H20N2O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 325.9ºC |
|---|
Names
| Name | 5-[[4-[2-(5-ethylpyridin-2-yl)ethoxy]phenyl]methyl]-5-hydroxy-1,3-thiazolidine-2,4-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.338g/cm3 |
|---|
| Boiling Point | 615.2ºC at 760 mmHg |
|---|
| Molecular Formula | C19H20N2O4S |
|---|
| Molecular Weight | 372.43800 |
|---|
| Flash Point | 325.9ºC |
|---|
| Exact Mass | 372.11400 |
|---|
| PSA | 113.82000 |
|---|
| LogP | 2.80840 |
|---|
| Index of Refraction | 1.635 |
|---|
| InChIKey | HDKWBDGQTUQSTO-UHFFFAOYSA-N |
|---|
| SMILES | CCc1ccc(CCOc2ccc(CC3(O)SC(=O)NC3=O)cc2)nc1 |
|---|
Synonyms
| Pioglitazone hydrochloride impurity,hydroxypioglitazone-[USP] |
| 5-Hydroxy PioglitazoneDiscontinued |
| 5-[[4-[2-(5-ETHYL-PYRIDIN-2-YL)ETHOXY]PHENYL]METHYL]-5-HYDROXY-2,4-THIAZOLIDINEDIONE |
| Pioglitazone hydrochloride impurity A [EP] |
| UNII-TP637L2U5K |
| 5-Hydroxy pioglitazone |
| 5-{4-[2-(5-Ethyl-2-pyridinyl)ethoxy]benzyl}-5-hydroxy-1,3-thiazolidine-2,4-dione |
| Pioglitazone Impurity 8 |
