Introduction：Basic information about CAS 5676-71-1|bis(4-methoxyphenyl) carbonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | bis(4-methoxyphenyl) carbonate |
|---|
| CAS Number | 5676-71-1 | Molecular Weight | 274.26900 |
|---|
| Density | 1.208g/cm3 | Boiling Point | 390.2ºC at 760 mmHg |
|---|
| Molecular Formula | C15H14O5 | Melting Point | 86-88ºC |
|---|
| MSDS | / | Flash Point | 172.5ºC |
|---|
Names
| Name | bis(4-methoxyphenyl) carbonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.208g/cm3 |
|---|
| Boiling Point | 390.2ºC at 760 mmHg |
|---|
| Melting Point | 86-88ºC |
|---|
| Molecular Formula | C15H14O5 |
|---|
| Molecular Weight | 274.26900 |
|---|
| Flash Point | 172.5ºC |
|---|
| Exact Mass | 274.08400 |
|---|
| PSA | 53.99000 |
|---|
| LogP | 3.28160 |
|---|
| Index of Refraction | 1.552 |
|---|
| InChIKey | PVBTWSPZTNYNHG-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(OC(=O)Oc2ccc(OC)cc2)cc1 |
|---|
Safety Information
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-37 |
|---|
Synonyms
| bis(p-methoxyphenyl) carbonate |
| di-p-methoxyphenyl carbonate |
| MFCD00798557 |
| 4-methoxyphenyl (4-methoxyphenoxy)formate |
| dianisyl carbonate |
| 4,4'-dimethoxydiphenyl carbonate |
| bis(4-methoxyphenyl)carbonate |
