Introduction：Basic information about CAS 175276-63-8|5-(4-Chlorophenyl)-2-methylfuran-3-carbonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(4-Chlorophenyl)-2-methylfuran-3-carbonyl chloride |
|---|
| CAS Number | 175276-63-8 | Molecular Weight | 255.09700 |
|---|
| Density | 1.327g/cm3 | Boiling Point | 343.6ºC at 760mmHg |
|---|
| Molecular Formula | C12H8Cl2O2 | Melting Point | 125-126ºC |
|---|
| MSDS | / | Flash Point | 161.6ºC |
|---|
Names
| Name | 5-(4-Chlorophenyl)-2-methylfuran-3-carbonyl chloride |
|---|
Chemical & Physical Properties
| Density | 1.327g/cm3 |
|---|
| Boiling Point | 343.6ºC at 760mmHg |
|---|
| Melting Point | 125-126ºC |
|---|
| Molecular Formula | C12H8Cl2O2 |
|---|
| Molecular Weight | 255.09700 |
|---|
| Flash Point | 161.6ºC |
|---|
| Exact Mass | 253.99000 |
|---|
| PSA | 30.21000 |
|---|
| LogP | 4.28740 |
|---|
| Vapour Pressure | 6.97E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.57 |
|---|
| InChIKey | FFBPNWVXORPKKH-UHFFFAOYSA-N |
|---|
| SMILES | Cc1oc(-c2ccc(Cl)cc2)cc1C(=O)Cl |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| HS Code | 2932190090 |
|---|
Customs
| HS Code | 2932190090 |
|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
