Introduction：Basic information about CAS 37067-27-9|Potassium Hydroquinone Monosulfate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Potassium Hydroquinone Monosulfate |
|---|
| CAS Number | 37067-27-9 | Molecular Weight | 228.26400 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C6H5KO5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | dipotassium,benzene-1,4-diol,sulfate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C6H5KO5S |
|---|
| Molecular Weight | 228.26400 |
|---|
| Exact Mass | 227.94900 |
|---|
| PSA | 95.04000 |
|---|
| LogP | 1.31200 |
|---|
| InChIKey | KYQHUXZXYUBUPX-UHFFFAOYSA-M |
|---|
| SMILES | O=S(=O)([O-])Oc1ccc(O)cc1.[K+] |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Safety Phrases | 24/25 |
|---|
| HS Code | 2920909090 |
|---|
Customs
| HS Code | 2920909090 |
|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Hydroquinone Monosulfate Potassium Salt |
| Hydrochinon-monosulfat |
| potassium p-hydroxyphenyl sulfate |
| hydroquinone sulphate potassium salt |
| EINECS 253-332-5 |
| PotassiuM Hydroquinone Monosulfate |
| potassium 4-hydroxyphenylsulfate |
