Introduction：Basic information about CAS 884507-12-4|6-Phenyl-3-pyridinesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Phenyl-3-pyridinesulfonyl chloride |
|---|
| CAS Number | 884507-12-4 | Molecular Weight | 253.70500 |
|---|
| Density | 1.374g/cm3 | Boiling Point | 388ºC at 760 mmHg |
|---|
| Molecular Formula | C11H8ClNO2S | Melting Point | 106.5ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 188.5ºC |
|---|
Names
| Name | 6-phenylpyridine-3-sulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.374g/cm3 |
|---|
| Boiling Point | 388ºC at 760 mmHg |
|---|
| Melting Point | 106.5ºC |
|---|
| Molecular Formula | C11H8ClNO2S |
|---|
| Molecular Weight | 253.70500 |
|---|
| Flash Point | 188.5ºC |
|---|
| Exact Mass | 252.99600 |
|---|
| PSA | 55.41000 |
|---|
| LogP | 3.75690 |
|---|
| Index of Refraction | 1.597 |
|---|
| InChIKey | XXAIRWVPDAMXOX-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Cl)c1ccc(-c2ccccc2)nc1 |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
Synonyms
| 6-Phenyl-3-pyridinesulfonyl chloride |
| 2-Phenylpyridine-5-sulphonyl chloride |
| 6-Phenylpyridine-3-sulphonyl chloride |
