Introduction：Basic information about CAS 70020-54-1|8-METHOXY LOXAPINE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 8-METHOXY LOXAPINE |
|---|
| CAS Number | 70020-54-1 | Molecular Weight | 357.83400 |
|---|
| Density | 1.31g/cm3 | Boiling Point | 504.4ºC at 760 mmHg |
|---|
| Molecular Formula | C19H20ClN3O2 | Melting Point | 56-58ºC |
|---|
| MSDS | / | Flash Point | 258.9ºC |
|---|
Names
| Name | 8-chloro-3-methoxy-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.31g/cm3 |
|---|
| Boiling Point | 504.4ºC at 760 mmHg |
|---|
| Melting Point | 56-58ºC |
|---|
| Molecular Formula | C19H20ClN3O2 |
|---|
| Molecular Weight | 357.83400 |
|---|
| Flash Point | 258.9ºC |
|---|
| Exact Mass | 357.12400 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 3.09140 |
|---|
| Index of Refraction | 1.641 |
|---|
| InChIKey | CQTLHLYDQYOEJW-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc2c(c1)N=C(N1CCN(C)CC1)c1cc(Cl)ccc1O2 |
|---|
Synonyms
| 8-Methoxy Loxapine |
| Methoxyloxapine |
| 2-Chloro-8-methoxy-11-(4-methyl-1-piperazinyl)dibenz[b,f][1,4]oxazepine |
