Introduction：Basic information about CAS 22319-48-8|Benzeneacetic acid, a-[[(phenylmethyl)amino]methyl]-,ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzeneacetic acid, a-[[(phenylmethyl)amino]methyl]-,ethyl ester |
|---|
| CAS Number | 22319-48-8 | Molecular Weight | 283.36500 |
|---|
| Density | 1.081g/cm3 | Boiling Point | 411.9ºC at 760 mmHg |
|---|
| Molecular Formula | C18H21NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 202.9ºC |
|---|
Names
| Name | ethyl 3-(benzylamino)-2-phenylpropanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.081g/cm3 |
|---|
| Boiling Point | 411.9ºC at 760 mmHg |
|---|
| Molecular Formula | C18H21NO2 |
|---|
| Molecular Weight | 283.36500 |
|---|
| Flash Point | 202.9ºC |
|---|
| Exact Mass | 283.15700 |
|---|
| PSA | 38.33000 |
|---|
| LogP | 3.51400 |
|---|
| Vapour Pressure | 5.39E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.555 |
|---|
| InChIKey | IQABQCDCJAKQRB-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(CNCc1ccccc1)c1ccccc1 |
|---|
Synonyms
| Ethyl-2-phenyl-3-N-benzylaminopropanoat |
| ethyl 3-benzylamino-2-phenyl-propionate |
| 3-Benzylamino-2-phenyl-propionsaeure-aethylester |
| ethyl 2-phenyl-3-(N-benzylamino)propionate |
| 3-benzylamino-2-phenyl-propionic acid ethyl ester |
