Introduction:Basic information about CAS 2415-87-4|N-[3-(Chloroacetyl)phenyl]acetamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-[3-(Chloroacetyl)phenyl]acetamide |
|---|
| CAS Number | 2415-87-4 | Molecular Weight | 211.645 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 423.8±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H10ClNO2 | Melting Point | 103 °C |
|---|
| MSDS | / | Flash Point | 210.1±23.2 °C |
|---|
Names
| Name | N-(3-Chlorophenyl)-3-oxobutanamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 423.8±25.0 °C at 760 mmHg |
|---|
| Melting Point | 103 °C |
|---|
| Molecular Formula | C10H10ClNO2 |
|---|
| Molecular Weight | 211.645 |
|---|
| Flash Point | 210.1±23.2 °C |
|---|
| Exact Mass | 211.040009 |
|---|
| PSA | 46.17000 |
|---|
| LogP | 1.28 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.584 |
|---|
| InChIKey | MTPKMGABYQNMMG-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)CC(=O)Nc1cccc(Cl)c1 |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N-[3-(Chloroacetyl)phenyl]acetamide |
| Acetamide, N-[3-(2-chloroacetyl)phenyl]- |
| N-(3-Chlorophenyl)-3-oxobutyramide |
| 3'-chloro-acetoacetanilide keto form |
| Acetessigsaeure-(3-chlor-anilid) |
| N-(3-chlorophenyl)acetoacetamide |
| n-(3-chloro-phenyl)-3-oxo-butyramide |
| acetoacetic acid-(3-chloro-anilide) |
| 3'-Chloroacetoacetanilide |
| 3-oxo-N-(3'-chlorophenyl)butanamide |
| Butanamide,N-(3-chlorophenyl)-3-oxo |