Introduction：Basic information about CAS 24744-58-9|Benzeneacetic acid,3,5-dibromo-4-hydroxy-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzeneacetic acid,3,5-dibromo-4-hydroxy- |
|---|
| CAS Number | 24744-58-9 | Molecular Weight | 309.93900 |
|---|
| Density | 2.098g/cm3 | Boiling Point | 377.6ºC at 760 mmHg |
|---|
| Molecular Formula | C8H6Br2O3 | Melting Point | 195 °C |
|---|
| MSDS | / | Flash Point | 182.2ºC |
|---|
Names
| Name | 2-(3,5-dibromo-4-hydroxyphenyl)acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.098g/cm3 |
|---|
| Boiling Point | 377.6ºC at 760 mmHg |
|---|
| Melting Point | 195 °C |
|---|
| Molecular Formula | C8H6Br2O3 |
|---|
| Molecular Weight | 309.93900 |
|---|
| Flash Point | 182.2ºC |
|---|
| Exact Mass | 307.86800 |
|---|
| PSA | 57.53000 |
|---|
| LogP | 2.54430 |
|---|
| Vapour Pressure | 2.25E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.661 |
|---|
| InChIKey | WZHLZXHHXUHDDU-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)Cc1cc(Br)c(O)c(Br)c1 |
|---|
Synonyms
| 4-Hydroxy-3.5-dibromphenylessigsaeure |
| 2-(2,2-DIMETHOXYETHYL)ANILINE,> |
| (3,5-dibromo-4-hydroxy-phenyl)-acetic acid |
| (3,5-Dibrom-4-hydroxy-phenyl)-essigsaeure |
