Introduction：Basic information about CAS 15850-20-1|Benzamide,4-nitro-N-2-thiazolyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzamide,4-nitro-N-2-thiazolyl- |
|---|
| CAS Number | 15850-20-1 | Molecular Weight | 249.24600 |
|---|
| Density | 1.53g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C10H7N3O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-(4-Nitrobenzoyl)imidazol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.53g/cm3 |
|---|
| Molecular Formula | C10H7N3O3S |
|---|
| Molecular Weight | 249.24600 |
|---|
| Exact Mass | 249.02100 |
|---|
| PSA | 116.05000 |
|---|
| LogP | 2.89980 |
|---|
| Index of Refraction | 1.713 |
|---|
| InChIKey | SXVKIMCWFQAXPM-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Nc1nccs1)c1ccc([N+](=O)[O-])cc1 |
|---|
Safety Information
Customs
| HS Code | 2934100090 |
|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| 4-Nitro-benzoesaeure-thiazol-2-ylamid |
| 2-(4-nitrobenzoyl)imidazole |
| 2-(4-Nitrobenzoylamino)thiazole |
| 4-nitro-benzoic acid thiazol-2-ylamide |
| Methanone,1H-imidazol-2-yl(4-nitrophenyl) |
| 2-(4-nitrobenzoyl)methylimidazole |
| 4-nitro-N-thiazol-2-yl-benzamide |
| 1H-imidazol-2-yl-4-nitrophenyl-methanone |
