Introduction：Basic information about CAS 5467-99-2|benzyl 4-methylbenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | benzyl 4-methylbenzoate |
|---|
| CAS Number | 5467-99-2 | Molecular Weight | 226.27000 |
|---|
| Density | 1.107g/cm3 | Boiling Point | 344.2ºC at 760 mmHg |
|---|
| Molecular Formula | C15H14O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 154.4ºC |
|---|
Names
| Name | benzyl 4-methylbenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.107g/cm3 |
|---|
| Boiling Point | 344.2ºC at 760 mmHg |
|---|
| Molecular Formula | C15H14O2 |
|---|
| Molecular Weight | 226.27000 |
|---|
| Flash Point | 154.4ºC |
|---|
| Exact Mass | 226.09900 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 3.35200 |
|---|
| Index of Refraction | 1.573 |
|---|
| InChIKey | LNXGEZSXCGDUSD-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(C(=O)OCc2ccccc2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 4-MeC6H4CO2Bn |
| (4-Me)C6H4CO2CH2C6H5 |
| Benzyl p-toluate |
| benzyl-4-methylbenzoate |
| 4-methylbenzoic acid benzyl ester |
| benzenemethyl 4-methylbenzoate |
| p-Toluic acid,benzyl ester |
