Introduction：Basic information about CAS 23530-47-4|Benzenesulfonamide,4-nitro-N-propyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenesulfonamide,4-nitro-N-propyl- |
|---|
| CAS Number | 23530-47-4 | Molecular Weight | 244.26800 |
|---|
| Density | 1.321g/cm3 | Boiling Point | 395.5ºC at 760 mmHg |
|---|
| Molecular Formula | C9H12N2O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 193ºC |
|---|
Names
| Name | 4-nitro-N-propylbenzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.321g/cm3 |
|---|
| Boiling Point | 395.5ºC at 760 mmHg |
|---|
| Molecular Formula | C9H12N2O4S |
|---|
| Molecular Weight | 244.26800 |
|---|
| Flash Point | 193ºC |
|---|
| Exact Mass | 244.05200 |
|---|
| PSA | 100.37000 |
|---|
| LogP | 3.27800 |
|---|
| Vapour Pressure | 1.82E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.552 |
|---|
| InChIKey | WPVVWLXGHXMNMA-UHFFFAOYSA-N |
|---|
| SMILES | CCCNS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
|---|
Synonyms
| 4-Nitro-benzolsulfonsaeure-propylamid |
| 4-Nitro-benzolsulfonsaeure-n-octylester |
| Benzenesulfonic acid,4-nitro-,octyl ester |
| 4-nitro-benzenesulfonic acid octyl ester |
| 4-nitro-benzenesulfonic acid propylamide |
| n-octyl p-nitrobenzenesulfonate |
| N-propyl-p-nitrobenzenesulfonamide |
| 4-Nitro-benzolsulfonsaeure-octylester |
