Introduction：Basic information about CAS 6219-63-2|2H,9H-Dipyrano(2,3-a:2,3,4-kl)xanthen-9-one, 3,4-dihydro-5-methoxy-8-methyl-2,1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2H,9H-Dipyrano(2,3-a:2,3,4-kl)xanthen-9-one, 3,4-dihydro-5-methoxy-8-methyl-2,12-diphenyl-, (-)- |
|---|
| CAS Number | 6219-63-2 | Molecular Weight | 488.53000 |
|---|
| Density | 1.38g/cm3 | Boiling Point | 767.3ºC at 760 mmHg |
|---|
| Molecular Formula | C32H24O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 324.9ºC |
|---|
Names
| Name | dracorubin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.38g/cm3 |
|---|
| Boiling Point | 767.3ºC at 760 mmHg |
|---|
| Molecular Formula | C32H24O5 |
|---|
| Molecular Weight | 488.53000 |
|---|
| Flash Point | 324.9ºC |
|---|
| Exact Mass | 488.16200 |
|---|
| PSA | 61.81000 |
|---|
| LogP | 7.74270 |
|---|
| Index of Refraction | 1.709 |
|---|
| InChIKey | FWKBXSPDFCAHFN-DEOSSOPVSA-N |
|---|
| SMILES | COc1cc2oc3c(C)c(=O)cc4oc(-c5ccccc5)cc(c2c2c1CCC(c1ccccc1)O2)c43 |
|---|
Synonyms
| Dracorubin |
| 2H,9H-Dipyrano[2,3-a_2',3',4'-kl]xanthen-9-one, 3,4-dihydro-5-methoxy-8-methyl-2,12-diphenyl-, (-)- |
