Introduction：Basic information about CAS 7508-05-6|Ethanone,1-(2,3,4,6-tetramethoxyphenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethanone,1-(2,3,4,6-tetramethoxyphenyl)- |
|---|
| CAS Number | 7508-05-6 | Molecular Weight | 240.25200 |
|---|
| Density | 1.107g/cm3 | Boiling Point | 358.3ºC at 760mmHg |
|---|
| Molecular Formula | C12H16O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 158.1ºC |
|---|
Names
| Name | 1-(2,3,4,6-tetramethoxyphenyl)ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.107g/cm3 |
|---|
| Boiling Point | 358.3ºC at 760mmHg |
|---|
| Molecular Formula | C12H16O5 |
|---|
| Molecular Weight | 240.25200 |
|---|
| Flash Point | 158.1ºC |
|---|
| Exact Mass | 240.10000 |
|---|
| PSA | 53.99000 |
|---|
| LogP | 1.92360 |
|---|
| Index of Refraction | 1.492 |
|---|
| InChIKey | FENZKGOUICFKMZ-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(OC)c(C(C)=O)c(OC)c1OC |
|---|
Synonyms
| 2,3,4,6-tetramethoxy-acetophenone |
| 1-(2.3.4.6-Tetramethoxy-phenyl)-aethanon-(1) |
| 1-(2,3,4,6-tetramethoxy-phenyl)-ethanone |
| 1-(2,3,4,6-Tetramethoxy-phenyl)-aethanon |
