Introduction：Basic information about CAS 17296-28-5|2-(2-methoxyphenyl)benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(2-methoxyphenyl)benzoic acid |
|---|
| CAS Number | 17296-28-5 | Molecular Weight | 228.243 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 344.7±17.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H12O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 128.7±14.4 °C |
|---|
Names
| Name | 2-(2-methoxyphenyl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 344.7±17.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H12O3 |
|---|
| Molecular Weight | 228.243 |
|---|
| Flash Point | 128.7±14.4 °C |
|---|
| Exact Mass | 228.078644 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 2.66 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.589 |
|---|
| InChIKey | DONMCRNZWAMEGC-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccccc1-c1ccccc1C(=O)O |
|---|
Safety Information
Customs
| HS Code | 2922299090 |
|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2'-Methoxy-biphenyl-2-carbonsaeure |
| 2'-Methoxy-2-biphenylcarboxylic acid |
| [1,2'-methoxy |
| 2'-methoxy[1,1'-biphenyl]-2-carboxylic acid |
| 2-biphenyl-(2'-methoxy)carboxylic acid |
| 2'-Methoxybiphenyl-2-carboxylic acid |
| [1,1'-Biphenyl]-2-carboxylic acid, 2'-methoxy- |
| 2'-IODO-5'-FLUOROACETOPHENONE |
| (2'-methoxy-biphenyl-2-yl)carboxylic acid |
| 2'-Methoxy-diphenyl-carbonsaeure-(2) |
