Introduction：Basic information about CAS 1184-10-7|2,2,4,4,6,6-Hexahydro-2,2,4,4,6,6-hexaphenoxytriazatriphosphorine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2,4,4,6,6-Hexahydro-2,2,4,4,6,6-hexaphenoxytriazatriphosphorine |
|---|
| CAS Number | 1184-10-7 | Molecular Weight | 693.561 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 280°C/0.1mmHg(lit.) |
|---|
| Molecular Formula | C36H30N3O6P3 | Melting Point | 112.0 to 116.0 deg-C |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 280°C/0.1mmHg(lit.) |
|---|
| Melting Point | 112.0 to 116.0 deg-C |
|---|
| Molecular Formula | C36H30N3O6P3 |
|---|
| Molecular Weight | 693.561 |
|---|
| Exact Mass | 693.134766 |
|---|
| PSA | 121.89000 |
|---|
| LogP | 10.61940 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.637 |
|---|
| InChIKey | RNFJDJUURJAICM-UHFFFAOYSA-N |
|---|
| SMILES | c1ccc(OP2(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=N2)cc1 |
|---|
Synonyms
| 2,2,4,4,6,6-Hexaphenoxy-1,3,5,2λ,4λ,6λ-triazatriphosphinine |
| 1,3,5,2,4,6-Triazatriphosphorine, 2,2,4,4,6,6-hexahydro-2,2,4,4,6,6-hexaphenoxy- |
| Hexaphenoxycyclotriphosphazatriene |
| 2,2,4,4,6,6-hexaphenoxycyclotriphosphazene |
| 2,2,4,4,6,6-hexakisphenoxycyclotriphosphazene |
| 2,2,4,4,6,6-hexaphenoxy-1,3,5,2lambda~5~,4lambda~5~,6lambda~5~-triazatriphosphinine |
