Introduction:Basic information about CAS 18826-13-6|4,4'-Bis(triphenylsilyl)-1,1'-biphenyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,4'-Bis(triphenylsilyl)-1,1'-biphenyl |
|---|
| CAS Number | 18826-13-6 | Molecular Weight | 670.98600 |
|---|
| Density | 1.17 | Boiling Point | 713.1ºC at 760 mmHg |
|---|
| Molecular Formula | C48H38Si2 | Melting Point | 292-293ºC |
|---|
| MSDS | / | Flash Point | 352.4ºC |
|---|
Names
| Name | triphenyl-[4-(4-triphenylsilylphenyl)phenyl]silane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.17 |
|---|
| Boiling Point | 713.1ºC at 760 mmHg |
|---|
| Melting Point | 292-293ºC |
|---|
| Molecular Formula | C48H38Si2 |
|---|
| Molecular Weight | 670.98600 |
|---|
| Flash Point | 352.4ºC |
|---|
| Exact Mass | 670.25100 |
|---|
| LogP | 6.10840 |
|---|
| Vapour Pressure | 2.33E-19mmHg at 25°C |
|---|
| Index of Refraction | 1.683 |
|---|
| InChIKey | LNQMQGXHWZCRFZ-UHFFFAOYSA-N |
|---|
| SMILES | c1ccc([Si](c2ccccc2)(c2ccccc2)c2ccc(-c3ccc([Si](c4ccccc4)(c4ccccc4)c4ccccc4)cc3)cc2)cc1 |
|---|
Synonyms
| 4,4'-bis-triphenylsilanyl-biphenyl |
| Hexa-Si-phenyl-Si,Si'-biphenyl-4,4'-diyl-bis-silan |
| hexa-Si-phenyl-Si,Si'-biphenyl-4,4'-diyl-bis-silane |