Introduction：Basic information about CAS 24109-06-6|N-(4-Bromophenyl)-2,2-dimethylpropanamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(4-Bromophenyl)-2,2-dimethylpropanamide |
|---|
| CAS Number | 24109-06-6 | Molecular Weight | 256.139 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 368.3±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H14BrNO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 176.5±23.2 °C |
|---|
Names
| Name | N-(4-Bromophenyl)-2,2-dimethylpropanamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 368.3±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H14BrNO |
|---|
| Molecular Weight | 256.139 |
|---|
| Flash Point | 176.5±23.2 °C |
|---|
| Exact Mass | 255.025864 |
|---|
| PSA | 29.10000 |
|---|
| LogP | 3.52 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.573 |
|---|
| InChIKey | ZXYSRVSPDUSHBX-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)C(=O)Nc1ccc(Br)cc1 |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N1-(4-bromophenyl)-2,2-dimethylpropanamide |
| N-(4-Bromophenyl)-2,2-dimethylpropanamide |
| CCG-831 |
| 4-bromo-N-pivaloylaniline |
| Propanamide,N-(4-bromophenyl)-2,2-dimethyl |
| 4-bromopivalanilide |
| pivalic acid-(4-bromo-anilide) |
| N-t-butylcarbonyl-4-bromoaniline |
| Pivalinsaeure-(4-brom-anilid) |
| Propanamide, N-(4-bromophenyl)-2,2-dimethyl- |
| N-(4-bromophenyl)pivalamide |
