CAS 29261-33-4|2,2'-(perfluorocyclohexa-2,5-diene-1,4-diylidene)dimalononitrile
| Common Name | 2,2'-(perfluorocyclohexa-2,5-diene-1,4-diylidene)dimalononitrile | ||
|---|---|---|---|
| CAS Number | 29261-33-4 | Molecular Weight | 276.149 |
| Density | 1.6±0.1 g/cm3 | Boiling Point | -89.6±40.0 °C at 760 mmHg |
| Molecular Formula | C12F4N4 | Melting Point | 285-290 °C(lit.) |
| MSDS | ChineseUSA | Flash Point | -100.4±27.3 °C |
| Symbol | GHS06 | Signal Word | Danger |
Names
| Name | 2-[4-(dicyanomethylidene)-2,3,5,6-tetrafluorocyclohexa-2,5-dien-1-ylidene]propanedinitrile |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | -89.6±40.0 °C at 760 mmHg |
| Melting Point | 285-290 °C(lit.) |
| Molecular Formula | C12F4N4 |
| Molecular Weight | 276.149 |
| Flash Point | -100.4±27.3 °C |
| Exact Mass | 276.005920 |
| PSA | 95.16000 |
| LogP | -0.28 |
| Vapour Pressure | 35523.6±0.1 mmHg at 25°C |
| Index of Refraction | 1.522 |
| InChIKey | IXHWGNYCZPISET-UHFFFAOYSA-N |
| SMILES | N#CC(C#N)=c1c(F)c(F)c(=C(C#N)C#N)c(F)c1F |
| Water Solubility | insoluble |
Safety Information
| Symbol | GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 + H311 + H331 |
| Precautionary Statements | P261-P280-P301 + P310-P311 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S22-S24/25-S36/37/39-S26 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2926909090 |
Customs
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
Articles5
More Articles| Charge-transfer crystallites as molecular electrical dopants. Nat. Commun. 6 , 8560, (2015) Ground-state integer charge transfer is commonly regarded as the basic mechanism of molecular electrical doping in both, conjugated polymers and oligomers. Here, we demonstrate that fundamentally diff... | |
| Freezing-in orientational disorder induces crossover from thermally-activated to temperature-independent transport in organic semiconductors. Nat. Commun. 5 , 5642, (2014) The crystalline structure of organic materials dictates their physical properties, but while significant research effort is geared towards understanding structure-property relationships in such materi... | |
| Aharonov-Bohm oscillations in a quasi-ballistic three-dimensional topological insulator nanowire. Nat. Commun. 6 , 7634, (2015) Aharonov-Bohm oscillations effectively demonstrate coherent, ballistic transport in mesoscopic rings and tubes. In three-dimensional topological insulator nanowires, they can be used to not only chara... |
Synonyms
| 2,3,5,6-Tetrafluoro-7,7,8,8,-tetracyano-quinodimethane |
| 2,3,5,6-Tetrafluoro-7,7',8,8'-tetracyanoquinodimethane |
| MFCD00042382 |
| (2,3,5,6-Tetrafluoro-2,5-cyclohexadiene-1,4-diylidene)dimalononitrile |
| Tetrafluorotetracyanoquinodimethane |
| TCNQF4 |
| 7,7,8,8-Tetracyano-2,3,5,6-tetrafluoroquinodimethane |
| 2,3,4,5-TETRAFLUOROPHENYLACETONITRILE |
| 2,2'-(Perfluorocyclohexa-2,5-diene-1,4-diylidene)dimalononitrile |
| F4TCNQ |
| 2,3,5,6-Tetrafluoro-7,7,8,8-tetracyanoquinodimethane |
| 2,2'-(2,3,5,6-Tetrafluoro-2,5-cyclohexadiene-1,4-diylidene)dimalononitrile |
| 2,2'-(2,3,5,6-Tetrafluorocyclohexa-2,5-diene-1,4-diylidene)dimalononitrile |
| Propanedinitrile, 2,2'-(2,3,5,6-tetrafluoro-2,5-cyclohexadiene-1,4-diylidene)bis- |
