Introduction：Basic information about CAS 101420-79-5|4-Iodo-3-nitrobenzonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Iodo-3-nitrobenzonitrile |
|---|
| CAS Number | 101420-79-5 | Molecular Weight | 274.015 |
|---|
| Density | 2.1±0.1 g/cm3 | Boiling Point | 330.7±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H3IN2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 153.8±26.5 °C |
|---|
Names
| Name | 4-Iodo-3-nitrobenzonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.1±0.1 g/cm3 |
|---|
| Boiling Point | 330.7±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H3IN2O2 |
|---|
| Molecular Weight | 274.015 |
|---|
| Flash Point | 153.8±26.5 °C |
|---|
| Exact Mass | 273.923920 |
|---|
| PSA | 69.61000 |
|---|
| LogP | 1.98 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.688 |
|---|
| InChIKey | PZAMZPVQVFOYHP-UHFFFAOYSA-N |
|---|
| SMILES | N#Cc1ccc(I)c([N+](=O)[O-])c1 |
|---|
Synonyms
| 1-Cyano-3-nitro-4-iodobenzene |
| 4-Iodo-3-nitro-benzonitrile |
| Benzonitrile, 4-iodo-3-nitro- |
| 4-Iodo-3-nitrobenzonitrile |
| 4-Jod-3-nitro-benzonitril |
| Benzonitrile,4-iodo-3-nitro |
