Introduction:Basic information about CAS 29021-91-8|Dibenzofuran-3-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dibenzofuran-3-carboxylic acid |
|---|
| CAS Number | 29021-91-8 | Molecular Weight | 212.20100 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C13H8O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Dibenzo[b,d]furan-3-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C13H8O3 |
|---|
| Molecular Weight | 212.20100 |
|---|
| Exact Mass | 212.04700 |
|---|
| PSA | 50.44000 |
|---|
| LogP | 3.28420 |
|---|
| InChIKey | IPAZMLAVBPDMLK-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc2c(c1)oc1ccccc12 |
|---|
Safety Information
Customs
| HS Code | 2932999099 |
|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1-Dibenzofuranamine |
| Dibenzofuran-3-carbonsaeure |
| 1-aminodibenzofuran |
| dibenzofurane-2-carboxylic acid |
| dibenzofuranamine |
| Dibenzofuran-1-ylamin |
| dibenzofuran-3-carboxylic acid |
| dibenzofuran-1-ylamine |
| 1-aminobenzofuran |