Introduction：Basic information about CAS 930836-30-9|chlorodifluoromethyl phenyl sulfone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | chlorodifluoromethyl phenyl sulfone |
|---|
| CAS Number | 930836-30-9 | Molecular Weight | 226.628 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 276.6±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H5ClF2O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 121.1±27.3 °C |
|---|
Names
| Name | [chloro(difluoro)methyl]sulfonylbenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 276.6±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H5ClF2O2S |
|---|
| Molecular Weight | 226.628 |
|---|
| Flash Point | 121.1±27.3 °C |
|---|
| Exact Mass | 225.966690 |
|---|
| PSA | 42.52000 |
|---|
| LogP | 3.20 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.502 |
|---|
| InChIKey | DZKIZVXCLNLUJF-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(c1ccccc1)C(F)(F)Cl |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Safety Phrases | 24/25 |
|---|
Synonyms
| Benzene, [(chlorodifluoromethyl)sulfonyl]- |
| {[Chloro(difluoro)methyl]sulfonyl}benzene |
| chlorodifluoromethylphenyl sulfone |
| chlorodifluoromethyl phenyl sulfone |
| ((Chlorodifluoromethyl)sulfonyl)benzene |
| 1-(Chlorodifluoromethylsulfonyl)benzene |
