Introduction：Basic information about CAS 17667-32-2|Methyl 2-bromo-4,5-dimethoxybenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 2-bromo-4,5-dimethoxybenzoate |
|---|
| CAS Number | 17667-32-2 | Molecular Weight | 275.09600 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C10H11BrO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Methyl 2-bromo-4,5-dimethoxybenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C10H11BrO4 |
|---|
| Molecular Weight | 275.09600 |
|---|
| Exact Mass | 273.98400 |
|---|
| PSA | 44.76000 |
|---|
| LogP | 2.25290 |
|---|
| InChIKey | BCUHOZBMHZWCGL-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(OC)c(OC)cc1Br |
|---|
Safety Information
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| methyl 6-bromoveratrate |
| 2-Brom-4,5-dimethoxy-benzoesaeure-methylester |
| methyl 6-bromo-3,4-dimethoxybenzoate |
| 2-bromo-4,5-dimethoxybenzoic acid methyl ester |
| methyl bromobenzoate |
| methyl 2-bromoveratrate |
| methyl-2-bromo-4,5-dimethoxybenzoate |
