Introduction:Basic information about CAS 24938-12-3|buta-1,3-diene,(E)-but-2-enedioic acid,styrene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | buta-1,3-diene,(E)-but-2-enedioic acid,styrene |
|---|
| CAS Number | 24938-12-3 | Molecular Weight | 274.31200 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C16H18O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | buta-1,3-diene,(E)-but-2-enedioic acid,styrene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C16H18O4 |
|---|
| Molecular Weight | 274.31200 |
|---|
| Exact Mass | 274.12100 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 3.39980 |
|---|
| InChIKey | PUEVFCCOBZIVDO-JITBQSAISA-N |
|---|
| SMILES | C=CC=C.C=Cc1ccccc1.O=C(O)C=CC(=O)O |
|---|
Synonyms
| Butadiene,styrene,fumaric acid polymer |
| Fumaric acid,styrene,butadiene polymer |
| Benzene,ethenyl-,polymer with 1,3-butadiene and trans-butenedioic acid |
| 2-Butenedioic acid (E)-,polymer with 1,3-butadiene and ethenylbenzene |
| 2-Butenedioic acid (2E)-,polymer with 1,3-butadiene and ethenylbenzene |