Introduction:Basic information about CAS 5280-74-0|N,N'-(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis[4-[(2-chlorophenyl)az, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N,N'-(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis[4-[(2-chlorophenyl)azo]-3-hydroxynaphthalene-2-carboxamide] |
|---|
| CAS Number | 5280-74-0 | Molecular Weight | 870.56400 |
|---|
| Density | 1.45g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C46H28Cl4N6O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1-[(2-Chlorophenyl)diazenyl]-N-[3,3'-dichloro-4'-({4-[(2-chloroph enyl)diazenyl]-3-hydroxy-2-naphthoyl}amino)-4-biphenylyl]-3-hydro xy-2-naphthamide |
|---|
Chemical & Physical Properties
| Density | 1.45g/cm3 |
|---|
| Molecular Formula | C46H28Cl4N6O4 |
|---|
| Molecular Weight | 870.56400 |
|---|
| Exact Mass | 868.09300 |
|---|
| PSA | 155.08000 |
|---|
| LogP | 15.78820 |
|---|
| Index of Refraction | 1.713 |
|---|
| InChIKey | XJAFNUYWDPNWST-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Nc1ccc(-c2ccc(NC(=O)c3cc4ccccc4c(N=Nc4ccccc4Cl)c3O)c(Cl)c2)cc1Cl)c1cc2ccccc2c(N=Nc2ccccc2Cl)c1O |
|---|