Introduction：Basic information about CAS 6657-37-0|methyl N-[4-[(2-chloro-4-nitrophenyl)azo]phenyl]-N-(2-cyanoethyl)-beta-alaninate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | methyl N-[4-[(2-chloro-4-nitrophenyl)azo]phenyl]-N-(2-cyanoethyl)-beta-alaninate |
|---|
| CAS Number | 6657-37-0 | Molecular Weight | 415.83000 |
|---|
| Density | 1.31g/cm3 | Boiling Point | 622.6ºC at 760 mmHg |
|---|
| Molecular Formula | C19H18ClN5O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 330.3ºC |
|---|
Names
| Name | Methyl N-{4-[(2-chloro-4-nitrophenyl)diazenyl]phenyl}-N-(2-cyanoe thyl)-β-alaninate |
|---|
Chemical & Physical Properties
| Density | 1.31g/cm3 |
|---|
| Boiling Point | 622.6ºC at 760 mmHg |
|---|
| Molecular Formula | C19H18ClN5O4 |
|---|
| Molecular Weight | 415.83000 |
|---|
| Flash Point | 330.3ºC |
|---|
| Exact Mass | 415.10500 |
|---|
| PSA | 123.87000 |
|---|
| LogP | 5.46998 |
|---|
| Index of Refraction | 1.608 |
|---|
| InChIKey | BMUXKUVOASOJKR-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)CCN(CCC#N)c1ccc(N=Nc2ccc([N+](=O)[O-])cc2Cl)cc1 |
|---|
