Introduction:Basic information about CAS 3779-63-3|(2,4,6-Trioxotriazine-1,3,5(2H,4H,6H)-Triyl)Tris(Hexamethylene) Isocyanate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2,4,6-Trioxotriazine-1,3,5(2H,4H,6H)-Triyl)Tris(Hexamethylene) Isocyanate |
|---|
| CAS Number | 3779-63-3 | Molecular Weight | 504.57900 |
|---|
| Density | 1.2g/cm3 | Boiling Point | 648.2ºC at 760mmHg |
|---|
| Molecular Formula | C24H36N6O6 | Melting Point | >300 °C |
|---|
| MSDS | / | Flash Point | 345.8ºC |
|---|
Names
| Name | 1,3,5-tris(6-isocyanatohexyl)-1,3,5-triazin-2,4,6-trione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2g/cm3 |
|---|
| Boiling Point | 648.2ºC at 760mmHg |
|---|
| Melting Point | >300 °C |
|---|
| Molecular Formula | C24H36N6O6 |
|---|
| Molecular Weight | 504.57900 |
|---|
| Flash Point | 345.8ºC |
|---|
| Exact Mass | 504.27000 |
|---|
| PSA | 154.29000 |
|---|
| LogP | 1.86030 |
|---|
| Index of Refraction | 1.601 |
|---|
| InChIKey | KCZQSKKNAGZQSZ-UHFFFAOYSA-N |
|---|
| SMILES | O=C=NCCCCCCn1c(=O)n(CCCCCCN=C=O)c(=O)n(CCCCCCN=C=O)c1=O |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2933699090 |
|---|
Customs
| HS Code | 2933699090 |
|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
|---|
Synonyms
| 1,3,5-tris[6-isocyanatohexyl]-2,4,6-trioxo-s-triazine |
| HMDI trimer |
| 1,3,5-Tris(6-isocyanatohexyl)-1,3,5-triazinane-2,4,6-trione |
| Lys(Z)-OBzl.TosOH |
| tris(6-isocyanatohexyl) isocyanurate |
| H-Lys(Z)-OBzl*TosOH |
| 1,3,5-Tris(isocyanatohexamethylene)isocyanurate |
| Desmodur N 3390 BA |
| TsOH*H-Lys(Z)-OBzl |
| trimeric hexamethylene diisocyanate |
| hexamethylene diisocyanate isocyanurate |
| (2,4,6-Trioxotriazine-1,3,5(2H,4H,6H)-Triyl)Tris(Hexamethylene) Isocyanate |