Introduction：Basic information about CAS 17354-63-1|Benzene,1-methoxy-4-(2-nitro-1-propen-1-yl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzene,1-methoxy-4-(2-nitro-1-propen-1-yl)- |
|---|
| CAS Number | 17354-63-1 | Molecular Weight | 193.19900 |
|---|
| Density | 1.156g/cm3 | Boiling Point | 321.7ºC at 760mmHg |
|---|
| Molecular Formula | C10H11NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 147.4ºC |
|---|
Names
| Name | 1-(p-methoxyphenyl)2-nitropropene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.156g/cm3 |
|---|
| Boiling Point | 321.7ºC at 760mmHg |
|---|
| Molecular Formula | C10H11NO3 |
|---|
| Molecular Weight | 193.19900 |
|---|
| Flash Point | 147.4ºC |
|---|
| Exact Mass | 193.07400 |
|---|
| PSA | 55.05000 |
|---|
| LogP | 2.85590 |
|---|
| Vapour Pressure | 0.000551mmHg at 25°C |
|---|
| Index of Refraction | 1.568 |
|---|
| InChIKey | XQGFRDLMKKKSAH-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C=C(C)[N+](=O)[O-])cc1 |
|---|
Safety Information
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| Benzene,1-methoxy-4-(2-nitro-1-propenyl) |
| 1-Methoxy-4-(2-nitro-1-propenyl)benzene |
| 1-(p-methoxyphenyl)-2-nitro-1-propene |
| p-(2-nitropropenyl)anisole |
| Einecs 241-381-5 |
| 1-(4-Methoxyphenyl)-2-nitropropen |
| 1-methyl-1-nitro-(4-methoxyphenyl)ethene |
| 1-(4-methoxyphenyl)-2-nitropropene |
| 2-Nitro-1-(4-methoxyphenyl)-1-propene |
| 1-methoxy-4-(2-nitroprop-1-enyl)benzene |
