Introduction：Basic information about CAS 32917-26-3|1,4-Dioxaspiro[4.5]dec-7-ene-8-carboxylic acid, 7-Methyl-, ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,4-Dioxaspiro[4.5]dec-7-ene-8-carboxylic acid, 7-Methyl-, ethyl ester |
|---|
| CAS Number | 32917-26-3 | Molecular Weight | 226.269 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 314.6±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H18O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 136.2±27.9 °C |
|---|
Names
| Name | ethyl 7-methyl-1,4-dioxaspiro[4.5]dec-7-ene-8-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 314.6±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H18O4 |
|---|
| Molecular Weight | 226.269 |
|---|
| Flash Point | 136.2±27.9 °C |
|---|
| Exact Mass | 226.120514 |
|---|
| PSA | 44.76000 |
|---|
| LogP | 2.56 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.499 |
|---|
| InChIKey | FNIGFCLKRHRVFJ-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C1=C(C)CC2(CC1)OCCO2 |
|---|
Synonyms
| ethyl 3-methylcyclo-hex-3-enone-4 carboxylate ethylene ketal |
| 1,4-Dioxaspiro[4.5]dec-7-ene-8-carboxylic acid, 7-methyl-, ethyl ester |
| ethyl 4,4-ethylenedioxy-2-methyl-1-cyclohexene-1-carboxylate |
| Ethyl 7-methyl-1,4-dioxaspiro[4.5]dec-7-ene-8-carboxylate |
| ethyl 4,4-ethylenedioxy-1-methylcyclohexanecarboxylate |
| Ethyl 3-Methyl-cyclohex-3-en-1-on-4-carboxylat ethylenketal |
